C25H28N2O4 — CID 142252128
methyl 2-(1-ethoxycarbonylpiperidin-4-yl)-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-10-carboxylate (PubChem CID 142252128) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 2-(1-ethoxycarbonylpiperidin-4-yl)-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-10-carboxylate.
| Compound Name | methyl 2-(1-ethoxycarbonylpiperidin-4-yl)-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-10-carboxylate |
|---|---|
| PubChem CID | 142252128 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl 2-(1-ethoxycarbonylpiperidin-4-yl)-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-10-carboxylate |
| SMILES | CCOC(=O)N1CCC(C2c3ccc(C)cc3C(C(=O)OC)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C25H28N2O4/c1-4-31-25(29)27-12-9-17(10-13-27)22-19-8-7-16(2)14-20(19)21(24(28)30-3)15-18-6-5-11-26-23(18)22/h5-8,11,14-15,17,22H,4,9-10,12-13H2,1-3H3 |
| InChIKey | KYRCDERFOGBFMA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |