C15H20N4O2 — CID 102625354
ethyl 4-(imidazo[1,2-a]pyridin-5-ylamino)piperidine-1-carboxylate (PubChem CID 102625354) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 4-(imidazo[1,2-a]pyridin-5-ylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(imidazo[1,2-a]pyridin-5-ylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102625354 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | ethyl 4-(imidazo[1,2-a]pyridin-5-ylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cccc3nccn23)CC1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-21-15(20)18-9-6-12(7-10-18)17-14-5-3-4-13-16-8-11-19(13)14/h3-5,8,11-12,17H,2,6-7,9-10H2,1H3 |
| InChIKey | YLNOYMYICFOULC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |