C13H17N3 — CID 102625859
N-(3-methylcyclopentyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625859) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(3-methylcyclopentyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(3-methylcyclopentyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625859 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-(3-methylcyclopentyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CC1CCC(Nc2cccc3nccn23)C1 |
| InChI | InChI=1S/C13H17N3/c1-10-5-6-11(9-10)15-13-4-2-3-12-14-7-8-16(12)13/h2-4,7-8,10-11,15H,5-6,9H2,1H3 |
| InChIKey | ONEKYFKFVJHLCG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |