C15H21N3 — CID 102625331
N-cyclooctylimidazo[1,2-a]pyridin-5-amine (PubChem CID 102625331) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-cyclooctylimidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-cyclooctylimidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625331 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-cyclooctylimidazo[1,2-a]pyridin-5-amine |
| SMILES | c1cc(NC2CCCCCCC2)n2ccnc2c1 |
| InChI | InChI=1S/C15H21N3/c1-2-4-7-13(8-5-3-1)17-15-10-6-9-14-16-11-12-18(14)15/h6,9-13,17H,1-5,7-8H2 |
| InChIKey | MTSKDZSUYGHVIQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |