C13H16ClN3 — CID 102627070
N-[(2-chlorocyclopentyl)methyl]imidazo[1,2-a]pyridin-5-amine (PubChem CID 102627070) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is N-[(2-chlorocyclopentyl)methyl]imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-[(2-chlorocyclopentyl)methyl]imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102627070 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[(2-chlorocyclopentyl)methyl]imidazo[1,2-a]pyridin-5-amine |
| SMILES | ClC1CCCC1CNc1cccc2nccn12 |
| InChI | InChI=1S/C13H16ClN3/c14-11-4-1-3-10(11)9-16-13-6-2-5-12-15-7-8-17(12)13/h2,5-8,10-11,16H,1,3-4,9H2 |
| InChIKey | KNLCMEIOMHBMNG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|