C11H15N3O2 — CID 107390183
N-(2,2-dimethoxyethyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 107390183) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(2,2-dimethoxyethyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 107390183 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(2,2-dimethoxyethyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | COC(CNc1cccc2nccn12)OC |
| InChI | InChI=1S/C11H15N3O2/c1-15-11(16-2)8-13-10-5-3-4-9-12-6-7-14(9)10/h3-7,11,13H,8H2,1-2H3 |
| InChIKey | CZFBBWYSLVOHFJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|