C14H22N4 — CID 106286977
3-ethyl-1-N-imidazo[1,2-a]pyridin-5-ylpentane-1,2-diamine (PubChem CID 106286977) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 3-ethyl-1-N-imidazo[1,2-a]pyridin-5-ylpentane-1,2-diamine.
| Compound Name | 3-ethyl-1-N-imidazo[1,2-a]pyridin-5-ylpentane-1,2-diamine |
|---|---|
| PubChem CID | 106286977 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 3-ethyl-1-N-imidazo[1,2-a]pyridin-5-ylpentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNc1cccc2nccn12 |
| InChI | InChI=1S/C14H22N4/c1-3-11(4-2)12(15)10-17-14-7-5-6-13-16-8-9-18(13)14/h5-9,11-12,17H,3-4,10,15H2,1-2H3 |
| InChIKey | NAHDJFMHXXKCKG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |