About 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol
2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol (PubChem CID 102625375) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol |
| PubChem CID | 102625375 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol |
| SMILES | CC(CO)Nc1cccc2nccn12 |
| InChI | InChI=1S/C10H13N3O/c1-8(7-14)12-10-4-2-3-9-11-5-6-13(9)10/h2-6,8,12,14H,7H2,1H3 |
| InChIKey | UXWVNPGRSFFSSK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol?
The IUPAC name of 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol (CID 102625375) is 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol.
What is the SMILES notation for 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol?
The canonical SMILES for 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol is CC(CO)Nc1cccc2nccn12.
What is the InChIKey of 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol?
The InChIKey is UXWVNPGRSFFSSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-8(7-14)12-10-4-2-3-9-11-5-6-13(9)10/h2-6,8,12,14H,7H2,1H3.
What are the key properties of 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol?
2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol has a molecular weight of 191.23 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(imidazo[1,2-a]pyridin-5-ylamino)propan-1-ol is sourced from PubChem (CID 102625375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).