C13H18ClN3 — CID 102627059
N-(1-chloro-4-methylpentan-2-yl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102627059) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-2-yl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(1-chloro-4-methylpentan-2-yl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102627059 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(1-chloro-4-methylpentan-2-yl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CC(C)CC(CCl)Nc1cccc2nccn12 |
| InChI | InChI=1S/C13H18ClN3/c1-10(2)8-11(9-14)16-13-5-3-4-12-15-6-7-17(12)13/h3-7,10-11,16H,8-9H2,1-2H3 |
| InChIKey | SXKHYIPSNCRLBJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|