C13H20N4 — CID 106155268
N'-imidazo[1,2-a]pyridin-5-yl-2-methylpentane-1,5-diamine (PubChem CID 106155268) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is N'-imidazo[1,2-a]pyridin-5-yl-2-methylpentane-1,5-diamine.
| Compound Name | N'-imidazo[1,2-a]pyridin-5-yl-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 106155268 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N'-imidazo[1,2-a]pyridin-5-yl-2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1cccc2nccn12 |
| InChI | InChI=1S/C13H20N4/c1-11(10-14)4-3-7-15-12-5-2-6-13-16-8-9-17(12)13/h2,5-6,8-9,11,15H,3-4,7,10,14H2,1H3 |
| InChIKey | HPBFUGPKFZBJDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|