C11H15N3 — CID 102625326
N-butylimidazo[1,2-a]pyridin-5-amine (PubChem CID 102625326) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-butylimidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-butylimidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625326 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-butylimidazo[1,2-a]pyridin-5-amine |
| SMILES | CCCCNc1cccc2nccn12 |
| InChI | InChI=1S/C11H15N3/c1-2-3-7-12-10-5-4-6-11-13-8-9-14(10)11/h4-6,8-9,12H,2-3,7H2,1H3 |
| InChIKey | OEMJLQLVOQIAGS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|