C14H21N3 — CID 102625728
N-(5-methylhexyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625728) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(5-methylhexyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(5-methylhexyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625728 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-(5-methylhexyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CC(C)CCCCNc1cccc2nccn12 |
| InChI | InChI=1S/C14H21N3/c1-12(2)6-3-4-9-15-13-7-5-8-14-16-10-11-17(13)14/h5,7-8,10-12,15H,3-4,6,9H2,1-2H3 |
| InChIKey | WWLHLKYXNVZSQV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|