C12H15N3 — CID 102625793
N-[(E)-pent-3-enyl]imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625793) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-[(E)-pent-3-enyl]imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625793 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-[(E)-pent-3-enyl]imidazo[1,2-a]pyridin-5-amine |
| SMILES | C/C=C/CCNc1cccc2nccn12 |
| InChI | InChI=1S/C12H15N3/c1-2-3-4-8-13-11-6-5-7-12-14-9-10-15(11)12/h2-3,5-7,9-10,13H,4,8H2,1H3/b3-2+ |
| InChIKey | NIVGEGXKBFFYIX-NSCUHMNNSA-N |
| XLogP | 2.71 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|