C13H18N4O2 — CID 102625776
3-(imidazo[1,2-a]pyridin-5-ylamino)-N-(2-methoxyethyl)propanamide (PubChem CID 102625776) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-5-ylamino)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-5-ylamino)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 102625776 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-5-ylamino)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1cccc2nccn12 |
| InChI | InChI=1S/C13H18N4O2/c1-19-10-8-16-13(18)5-6-14-11-3-2-4-12-15-7-9-17(11)12/h2-4,7,9,14H,5-6,8,10H2,1H3,(H,16,18) |
| InChIKey | XVDFXZGOIBXWDS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|