C17H19N3 — CID 102625526
N-(4-phenylbutan-2-yl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625526) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(4-phenylbutan-2-yl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625526 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-(4-phenylbutan-2-yl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CC(CCc1ccccc1)Nc1cccc2nccn12 |
| InChI | InChI=1S/C17H19N3/c1-14(10-11-15-6-3-2-4-7-15)19-17-9-5-8-16-18-12-13-20(16)17/h2-9,12-14,19H,10-11H2,1H3 |
| InChIKey | FBGSNPSBQBOPJS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |