C14H20N4O — CID 102625769
N,N-diethyl-2-(imidazo[1,2-a]pyridin-5-ylamino)propanamide (PubChem CID 102625769) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N,N-diethyl-2-(imidazo[1,2-a]pyridin-5-ylamino)propanamide.
| Compound Name | N,N-diethyl-2-(imidazo[1,2-a]pyridin-5-ylamino)propanamide |
|---|---|
| PubChem CID | 102625769 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N,N-diethyl-2-(imidazo[1,2-a]pyridin-5-ylamino)propanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1cccc2nccn12 |
| InChI | InChI=1S/C14H20N4O/c1-4-17(5-2)14(19)11(3)16-13-8-6-7-12-15-9-10-18(12)13/h6-11,16H,4-5H2,1-3H3 |
| InChIKey | LREQCWHFSGPDPR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |