C16H17N3O2 — CID 102625613
N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625613) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625613 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-a]pyridin-5-amine |
| SMILES | COc1ccc(CNc2cccc3nccn23)c(OC)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-20-13-7-6-12(14(10-13)21-2)11-18-16-5-3-4-15-17-8-9-19(15)16/h3-10,18H,11H2,1-2H3 |
| InChIKey | HVEUXPKZKLFVAI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |