C12H15N3S2 — CID 102625824
N-(1,4-dithian-2-ylmethyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625824) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625824 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | c1cc(NCC2CSCCS2)n2ccnc2c1 |
| InChI | InChI=1S/C12H15N3S2/c1-2-11-13-4-5-15(11)12(3-1)14-8-10-9-16-6-7-17-10/h1-5,10,14H,6-9H2 |
| InChIKey | BEVOMHMPIYKMRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |