C11H19N3S2 — CID 106580111
N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylimidazol-2-amine (PubChem CID 106580111) has the molecular formula C11H19N3S2 and a molecular weight of 257.43 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylimidazol-2-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 106580111 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylimidazol-2-amine |
| SMILES | CC(C)n1ccnc1NCC1CSCCS1 |
| InChI | InChI=1S/C11H19N3S2/c1-9(2)14-4-3-12-11(14)13-7-10-8-15-5-6-16-10/h3-4,9-10H,5-8H2,1-2H3,(H,12,13) |
| InChIKey | TWMKQTXCOGRJNM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |