C11H17N3S2 — CID 106580126
N-cyclopropyl-1-(1,4-dithian-2-ylmethyl)imidazol-2-amine (PubChem CID 106580126) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is N-cyclopropyl-1-(1,4-dithian-2-ylmethyl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-1-(1,4-dithian-2-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580126 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-cyclopropyl-1-(1,4-dithian-2-ylmethyl)imidazol-2-amine |
| SMILES | c1cn(CC2CSCCS2)c(NC2CC2)n1 |
| InChI | InChI=1S/C11H17N3S2/c1-2-9(1)13-11-12-3-4-14(11)7-10-8-15-5-6-16-10/h3-4,9-10H,1-2,5-8H2,(H,12,13) |
| InChIKey | QLOLVNSFPYWOLO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |