C11H19N3S — CID 106576814
N-propyl-1-(thiolan-2-ylmethyl)imidazol-2-amine (PubChem CID 106576814) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N-propyl-1-(thiolan-2-ylmethyl)imidazol-2-amine.
| Compound Name | N-propyl-1-(thiolan-2-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106576814 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-propyl-1-(thiolan-2-ylmethyl)imidazol-2-amine |
| SMILES | CCCNc1nccn1CC1CCCS1 |
| InChI | InChI=1S/C11H19N3S/c1-2-5-12-11-13-6-7-14(11)9-10-4-3-8-15-10/h6-7,10H,2-5,8-9H2,1H3,(H,12,13) |
| InChIKey | XCMIVQFXYQUYRW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |