C13H23N3OS — CID 106576791
1-(3-ethoxypropyl)-N-(thiolan-2-ylmethyl)imidazol-2-amine (PubChem CID 106576791) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-(thiolan-2-ylmethyl)imidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-(thiolan-2-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106576791 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-(thiolan-2-ylmethyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1NCC1CCCS1 |
| InChI | InChI=1S/C13H23N3OS/c1-2-17-9-4-7-16-8-6-14-13(16)15-11-12-5-3-10-18-12/h6,8,12H,2-5,7,9-11H2,1H3,(H,14,15) |
| InChIKey | NACVAMFCQRFRHI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|