C14H25N3O2 — CID 106566033
1-(3-ethoxypropyl)-N-(oxan-3-ylmethyl)imidazol-2-amine (PubChem CID 106566033) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-(oxan-3-ylmethyl)imidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-(oxan-3-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106566033 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-(oxan-3-ylmethyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1NCC1CCCOC1 |
| InChI | InChI=1S/C14H25N3O2/c1-2-18-10-4-7-17-8-6-15-14(17)16-11-13-5-3-9-19-12-13/h6,8,13H,2-5,7,9-12H2,1H3,(H,15,16) |
| InChIKey | YLNBFGWLMMBZLX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|