C15H28N4O — CID 106559623
1-(3-ethoxypropyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]imidazol-2-amine (PubChem CID 106559623) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]imidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106559623 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1NCC1CCCN1CC |
| InChI | InChI=1S/C15H28N4O/c1-3-18-9-5-7-14(18)13-17-15-16-8-11-19(15)10-6-12-20-4-2/h8,11,14H,3-7,9-10,12-13H2,1-2H3,(H,16,17) |
| InChIKey | MWMCQHZOZMOKFY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|