About N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine
N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine (PubChem CID 106574105) has the molecular formula C14H27N5O
and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine |
| PubChem CID | 106574105 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine |
| SMILES | COCCCn1ccnc1NCC1CN(C)CCN1C |
| InChI | InChI=1S/C14H27N5O/c1-17-8-9-18(2)13(12-17)11-16-14-15-5-7-19(14)6-4-10-20-3/h5,7,13H,4,6,8-12H2,1-3H3,(H,15,16) |
| InChIKey | NZUATMRQITUUNG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine?
The IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine (CID 106574105) is N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine.
What is the SMILES notation for N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine?
The canonical SMILES for N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine is COCCCn1ccnc1NCC1CN(C)CCN1C.
What is the InChIKey of N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine?
The InChIKey is NZUATMRQITUUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O/c1-17-8-9-18(2)13(12-17)11-16-14-15-5-7-19(14)6-4-10-20-3/h5,7,13H,4,6,8-12H2,1-3H3,(H,15,16).
What are the key properties of N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine?
N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine has a molecular weight of 281.40 g/mol, XLogP of 0.58, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine is sourced from PubChem (CID 106574105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).