C14H27N5O — CID 106574105
N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine (PubChem CID 106574105) has the molecular formula C14H27N5O and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106574105 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methoxypropyl)imidazol-2-amine |
| SMILES | COCCCn1ccnc1NCC1CN(C)CCN1C |
| InChI | InChI=1S/C14H27N5O/c1-17-8-9-18(2)13(12-17)11-16-14-15-5-7-19(14)6-4-10-20-3/h5,7,13H,4,6,8-12H2,1-3H3,(H,15,16) |
| InChIKey | NZUATMRQITUUNG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|