C12H23N3O2S — CID 106580528
1-(3-ethoxypropyl)-N-(3-methylsulfinylpropyl)imidazol-2-amine (PubChem CID 106580528) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-(3-methylsulfinylpropyl)imidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-(3-methylsulfinylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580528 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-(3-methylsulfinylpropyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1NCCCS(C)=O |
| InChI | InChI=1S/C12H23N3O2S/c1-3-17-10-5-8-15-9-7-14-12(15)13-6-4-11-18(2)16/h7,9H,3-6,8,10-11H2,1-2H3,(H,13,14) |
| InChIKey | AKMMVTMNZADWPF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|