C10H17N3OS — CID 106580517
N-(3-methylsulfinylpropyl)-1-prop-2-enylimidazol-2-amine (PubChem CID 106580517) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(3-methylsulfinylpropyl)-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-(3-methylsulfinylpropyl)-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106580517 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(3-methylsulfinylpropyl)-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1ccnc1NCCCS(C)=O |
| InChI | InChI=1S/C10H17N3OS/c1-3-7-13-8-6-12-10(13)11-5-4-9-15(2)14/h3,6,8H,1,4-5,7,9H2,2H3,(H,11,12) |
| InChIKey | GUUGLLVVIKLPJV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|