C10H17N3OS — CID 106580550
N-cyclopropyl-1-(3-methylsulfinylpropyl)imidazol-2-amine (PubChem CID 106580550) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-cyclopropyl-1-(3-methylsulfinylpropyl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-1-(3-methylsulfinylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580550 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-cyclopropyl-1-(3-methylsulfinylpropyl)imidazol-2-amine |
| SMILES | CS(=O)CCCn1ccnc1NC1CC1 |
| InChI | InChI=1S/C10H17N3OS/c1-15(14)8-2-6-13-7-5-11-10(13)12-9-3-4-9/h5,7,9H,2-4,6,8H2,1H3,(H,11,12) |
| InChIKey | ZFZJFUIKBYNLOC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |