C13H22N4 — CID 106583084
N-[[1-(dimethylamino)cyclobutyl]methyl]-1-prop-2-enylimidazol-2-amine (PubChem CID 106583084) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106583084 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1ccnc1NCC1(N(C)C)CCC1 |
| InChI | InChI=1S/C13H22N4/c1-4-9-17-10-8-14-12(17)15-11-13(16(2)3)6-5-7-13/h4,8,10H,1,5-7,9,11H2,2-3H3,(H,14,15) |
| InChIKey | KZAQENYNJVSBDH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|