C9H17N3O — CID 106555069
1-(3-ethoxypropyl)-N-methylimidazol-2-amine (PubChem CID 106555069) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-methylimidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106555069 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-methylimidazol-2-amine |
| SMILES | CCOCCCn1ccnc1NC |
| InChI | InChI=1S/C9H17N3O/c1-3-13-8-4-6-12-7-5-11-9(12)10-2/h5,7H,3-4,6,8H2,1-2H3,(H,10,11) |
| InChIKey | HSZFFXZNUNLKRG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|