C14H17Cl2N3O — CID 106560302
N-(2,3-dichlorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine (PubChem CID 106560302) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine.
| Compound Name | N-(2,3-dichlorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106560302 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2N3O/c1-2-20-10-4-8-19-9-7-17-14(19)18-12-6-3-5-11(15)13(12)16/h3,5-7,9H,2,4,8,10H2,1H3,(H,17,18) |
| InChIKey | BOIHPFWDIQTEMC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|