C14H16F3N3O — CID 106570947
1-(3-ethoxypropyl)-N-(2,3,5-trifluorophenyl)imidazol-2-amine (PubChem CID 106570947) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-(2,3,5-trifluorophenyl)imidazol-2-amine.
| Compound Name | 1-(3-ethoxypropyl)-N-(2,3,5-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570947 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-(2,3,5-trifluorophenyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C14H16F3N3O/c1-2-21-7-3-5-20-6-4-18-14(20)19-12-9-10(15)8-11(16)13(12)17/h4,6,8-9H,2-3,5,7H2,1H3,(H,18,19) |
| InChIKey | VKRZRBXKBPVPCZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|