C14H17ClFN3O — CID 106568955
N-(4-chloro-2-fluorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine (PubChem CID 106568955) has the molecular formula C14H17ClFN3O and a molecular weight of 297.76 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106568955 |
| Molecular Formula | C14H17ClFN3O |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-1-(3-ethoxypropyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H17ClFN3O/c1-2-20-9-3-7-19-8-6-17-14(19)18-13-5-4-11(15)10-12(13)16/h4-6,8,10H,2-3,7,9H2,1H3,(H,17,18) |
| InChIKey | ROFGWWMGFILJQI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|