C9H13N3OS2 — CID 115689484
3-(1,4-dithian-2-ylmethylamino)-1H-pyrazin-2-one (PubChem CID 115689484) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is 3-(1,4-dithian-2-ylmethylamino)-1H-pyrazin-2-one.
| Compound Name | 3-(1,4-dithian-2-ylmethylamino)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 115689484 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-(1,4-dithian-2-ylmethylamino)-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1NCC1CSCCS1 |
| InChI | InChI=1S/C9H13N3OS2/c13-9-8(10-1-2-11-9)12-5-7-6-14-3-4-15-7/h1-2,7H,3-6H2,(H,10,12)(H,11,13) |
| InChIKey | AXDQBQIWKKHQHD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |