C12H19N3O — CID 115657213
3-[(2-methylcyclohexyl)methylamino]-1H-pyrazin-2-one (PubChem CID 115657213) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(2-methylcyclohexyl)methylamino]-1H-pyrazin-2-one.
| Compound Name | 3-[(2-methylcyclohexyl)methylamino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 115657213 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-[(2-methylcyclohexyl)methylamino]-1H-pyrazin-2-one |
| SMILES | CC1CCCCC1CNc1ncc[nH]c1=O |
| InChI | InChI=1S/C12H19N3O/c1-9-4-2-3-5-10(9)8-15-11-12(16)14-7-6-13-11/h6-7,9-10H,2-5,8H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | AIZFBNCFJAQRKP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |