C14H21N3O — CID 55009920
2-[(2-methylcyclohexyl)methylamino]pyridine-3-carboxamide (PubChem CID 55009920) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(2-methylcyclohexyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 2-[(2-methylcyclohexyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55009920 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-[(2-methylcyclohexyl)methylamino]pyridine-3-carboxamide |
| SMILES | CC1CCCCC1CNc1ncccc1C(N)=O |
| InChI | InChI=1S/C14H21N3O/c1-10-5-2-3-6-11(10)9-17-14-12(13(15)18)7-4-8-16-14/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | LDSXWVBKLVAVOW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |