C13H19N3O2 — CID 80517643
3-[(2-methylcyclohexyl)methylamino]pyridazine-4-carboxylic acid (PubChem CID 80517643) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-[(2-methylcyclohexyl)methylamino]pyridazine-4-carboxylic acid.
| Compound Name | 3-[(2-methylcyclohexyl)methylamino]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80517643 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-[(2-methylcyclohexyl)methylamino]pyridazine-4-carboxylic acid |
| SMILES | CC1CCCCC1CNc1nnccc1C(=O)O |
| InChI | InChI=1S/C13H19N3O2/c1-9-4-2-3-5-10(9)8-14-12-11(13(17)18)6-7-15-16-12/h6-7,9-10H,2-5,8H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | UZRRFPLTRBGAMJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |