C15H20N4O — CID 102625691
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 102625691) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102625691 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | c1cc(NCC2CN3CCCC3CO2)n2ccnc2c1 |
| InChI | InChI=1S/C15H20N4O/c1-4-14-16-6-8-19(14)15(5-1)17-9-13-10-18-7-2-3-12(18)11-20-13/h1,4-6,8,12-13,17H,2-3,7,9-11H2 |
| InChIKey | LLPUVCOICPREQI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |