C15H20N4O — CID 97101958
2-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methylamino]pyridine-3-carbonitrile (PubChem CID 97101958) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97101958 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NC[C@@H]1CN2CCCC[C@@H]2CO1 |
| InChI | InChI=1S/C15H20N4O/c16-8-12-4-3-6-17-15(12)18-9-14-10-19-7-2-1-5-13(19)11-20-14/h3-4,6,13-14H,1-2,5,7,9-11H2,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | WDURPBQFPQRPBG-ZIAGYGMSSA-N |
| XLogP | 1.62 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |