C12H19N5O — CID 79916509
4-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 79916509) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79916509 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 4-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H19N5O/c13-11-5-14-8-16-12(11)15-4-10-6-17-3-1-2-9(17)7-18-10/h5,8-10H,1-4,6-7,13H2,(H,14,15,16) |
| InChIKey | IYEQNTYDDYLUHE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |