C14H19Cl2N3O — CID 106890562
1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,6-dichlorobenzene-1,4-diamine (PubChem CID 106890562) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,6-dichlorobenzene-1,4-diamine.
| Compound Name | 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,6-dichlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 106890562 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,6-dichlorobenzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NCC2CN3CCCC3CO2)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3O/c15-12-4-9(17)5-13(16)14(12)18-6-11-7-19-3-1-2-10(19)8-20-11/h4-5,10-11,18H,1-3,6-8,17H2 |
| InChIKey | AXEDHTVJMREZDA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|