C14H20ClFN4O — CID 103553266
1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-chloro-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553266) has the molecular formula C14H20ClFN4O and a molecular weight of 314.79 g/mol. Its IUPAC name is 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-chloro-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553266 |
| Molecular Formula | C14H20ClFN4O |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(NCC2CN3CCCC3CO2)c(F)c1Cl |
| InChI | InChI=1S/C14H20ClFN4O/c15-12-10(17)4-11(18)14(13(12)16)19-5-9-6-20-3-1-2-8(20)7-21-9/h4,8-9,19H,1-3,5-7,17-18H2 |
| InChIKey | BZJIEUFRMWRLKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|