C14H18N4O — CID 79071619
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyridine-2-carbonitrile (PubChem CID 79071619) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyridine-2-carbonitrile.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 79071619 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(NCC2CN3CCCC3CO2)ccn1 |
| InChI | InChI=1S/C14H18N4O/c15-7-12-6-11(3-4-16-12)17-8-14-9-18-5-1-2-13(18)10-19-14/h3-4,6,13-14H,1-2,5,8-10H2,(H,16,17) |
| InChIKey | OTOMDNLIWJAFKZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |