C13H19N5OS — CID 107547692
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyrimidine-4-carbothioamide (PubChem CID 107547692) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyrimidine-4-carbothioamide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547692 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(NCC2CN3CCCC3CO2)n1 |
| InChI | InChI=1S/C13H19N5OS/c14-12(20)11-3-4-15-13(17-11)16-6-10-7-18-5-1-2-9(18)8-19-10/h3-4,9-10H,1-2,5-8H2,(H2,14,20)(H,15,16,17) |
| InChIKey | WPCKJAKLHVGGSI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|