C15H20BrN3OS — CID 114903338
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)-4-bromobenzenecarbothioamide (PubChem CID 114903338) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)-4-bromobenzenecarbothioamide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)-4-bromobenzenecarbothioamide |
|---|---|
| PubChem CID | 114903338 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)-4-bromobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H20BrN3OS/c16-10-3-4-13(15(17)21)14(6-10)18-7-12-8-19-5-1-2-11(19)9-20-12/h3-4,6,11-12,18H,1-2,5,7-9H2,(H2,17,21) |
| InChIKey | LSPHYAOTDWNHON-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|