C13H18N4O3 — CID 78992980
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-nitropyridin-3-amine (PubChem CID 78992980) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-nitropyridin-3-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-nitropyridin-3-amine |
|---|---|
| PubChem CID | 78992980 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-nitropyridin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(NCC2CN3CCCC3CO2)cn1 |
| InChI | InChI=1S/C13H18N4O3/c18-17(19)13-4-3-10(6-15-13)14-7-12-8-16-5-1-2-11(16)9-20-12/h3-4,6,11-12,14H,1-2,5,7-9H2 |
| InChIKey | VKWUMSISFIHJLK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|