C14H19N5O — CID 102625426
2-[4-(imidazo[1,2-a]pyridin-5-ylamino)piperidin-1-yl]acetamide (PubChem CID 102625426) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[4-(imidazo[1,2-a]pyridin-5-ylamino)piperidin-1-yl]acetamide.
| Compound Name | 2-[4-(imidazo[1,2-a]pyridin-5-ylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 102625426 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[4-(imidazo[1,2-a]pyridin-5-ylamino)piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(Nc2cccc3nccn23)CC1 |
| InChI | InChI=1S/C14H19N5O/c15-12(20)10-18-7-4-11(5-8-18)17-14-3-1-2-13-16-6-9-19(13)14/h1-3,6,9,11,17H,4-5,7-8,10H2,(H2,15,20) |
| InChIKey | QSWJTIUFJFRKKQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |