C26H31ClN2O5S — CID 59677283
ethyl 4-[13-chloro-10-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidine-1-carboxylate (PubChem CID 59677283) has the molecular formula C26H31ClN2O5S and a molecular weight of 519.06 g/mol. Its IUPAC name is ethyl 4-[13-chloro-10-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[13-chloro-10-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59677283 |
| Molecular Formula | C26H31ClN2O5S |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | ethyl 4-[13-chloro-10-(3-methylsulfonyloxypropyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C2c3ccc(Cl)cc3C(CCCOS(C)(=O)=O)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C26H31ClN2O5S/c1-3-33-26(30)29-13-10-18(11-14-29)24-22-9-8-21(27)17-23(22)19(7-5-15-34-35(2,31)32)16-20-6-4-12-28-25(20)24/h4,6,8-9,12,16-18,24H,3,5,7,10-11,13-15H2,1-2H3 |
| InChIKey | XPKPAWFPFNYYNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|