C8H8FN5O3 — CID 90876369
2-[(2-fluoro-5-nitrophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 90876369) has the molecular formula C8H8FN5O3 and a molecular weight of 241.18 g/mol. Its IUPAC name is 2-[(2-fluoro-5-nitrophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(2-fluoro-5-nitrophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 90876369 |
| Molecular Formula | C8H8FN5O3 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-[(2-fluoro-5-nitrophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | NC(=NN=Cc1cc([N+](=O)[O-])ccc1F)NO |
| InChI | InChI=1S/C8H8FN5O3/c9-7-2-1-6(14(16)17)3-5(7)4-11-12-8(10)13-15/h1-4,15H,(H3,10,12,13) |
| InChIKey | ZQHIJLSIKJYVCW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|