C8H10N6O5 — CID 135822056
1-(dihydroxyamino)-2-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]guanidine (PubChem CID 135822056) has the molecular formula C8H10N6O5 and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-(dihydroxyamino)-2-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]guanidine.
| Compound Name | 1-(dihydroxyamino)-2-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 135822056 |
| Molecular Formula | C8H10N6O5 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(dihydroxyamino)-2-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]guanidine |
| SMILES | NC(=N/N=C/c1cc([N+](=O)[O-])ccc1O)NN(O)O |
| InChI | InChI=1S/C8H10N6O5/c9-8(12-14(18)19)11-10-4-5-3-6(13(16)17)1-2-7(5)15/h1-4,15,18-19H,(H3,9,11,12)/b10-4+ |
| InChIKey | NVLKZFNFDBXIFG-ONNFQVAWSA-N |
| XLogP | -0.47 |
| TPSA | 169.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|